About bis(2,2,2-trifluoroethyl) 2-(2-methylprop-2-enoyloxy)butanedioate
bis(2,2,2-trifluoroethyl) 2-(2-methylprop-2-enoyloxy)butanedioate (PubChem CID 89116225) has the molecular formula C12H12F6O6
and a molecular weight of 366.21 g/mol. Its IUPAC name is bis(2,2,2-trifluoroethyl) 2-(2-methylprop-2-enoyloxy)butanedioate.
Molecular Properties
| Compound Name | bis(2,2,2-trifluoroethyl) 2-(2-methylprop-2-enoyloxy)butanedioate |
| PubChem CID | 89116225 |
| Molecular Formula | C12H12F6O6 |
| Molecular Weight | 366.21 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | bis(2,2,2-trifluoroethyl) 2-(2-methylprop-2-enoyloxy)butanedioate |
| SMILES | C=C(C)C(=O)OC(CC(=O)OCC(F)(F)F)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C12H12F6O6/c1-6(2)9(20)24-7(10(21)23-5-12(16,17)18)3-8(19)22-4-11(13,14)15/h7H,1,3-5H2,2H3 |
| InChIKey | ICMFOINQWAYSGR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.21 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis(2,2,2-trifluoroethyl) 2-(2-methylprop-2-enoyloxy)butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,2,2-trifluoroethyl) 2-(2-methylprop-2-enoyloxy)butanedioate?
The IUPAC name of bis(2,2,2-trifluoroethyl) 2-(2-methylprop-2-enoyloxy)butanedioate (CID 89116225) is bis(2,2,2-trifluoroethyl) 2-(2-methylprop-2-enoyloxy)butanedioate.
What is the SMILES notation for bis(2,2,2-trifluoroethyl) 2-(2-methylprop-2-enoyloxy)butanedioate?
The canonical SMILES for bis(2,2,2-trifluoroethyl) 2-(2-methylprop-2-enoyloxy)butanedioate is C=C(C)C(=O)OC(CC(=O)OCC(F)(F)F)C(=O)OCC(F)(F)F.
What is the InChIKey of bis(2,2,2-trifluoroethyl) 2-(2-methylprop-2-enoyloxy)butanedioate?
The InChIKey is ICMFOINQWAYSGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F6O6/c1-6(2)9(20)24-7(10(21)23-5-12(16,17)18)3-8(19)22-4-11(13,14)15/h7H,1,3-5H2,2H3.
What are the key properties of bis(2,2,2-trifluoroethyl) 2-(2-methylprop-2-enoyloxy)butanedioate?
bis(2,2,2-trifluoroethyl) 2-(2-methylprop-2-enoyloxy)butanedioate has a molecular weight of 366.21 g/mol, XLogP of 2.08, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,2,2-trifluoroethyl) 2-(2-methylprop-2-enoyloxy)butanedioate is sourced from PubChem (CID 89116225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).