C14H10F12O6 — CID 89116230
bis(1,1,1,3,3,3-hexafluoropropan-2-yl) 2-(2-methylprop-2-enoyloxy)butanedioate (PubChem CID 89116230) has the molecular formula C14H10F12O6 and a molecular weight of 502.20 g/mol. Its IUPAC name is bis(1,1,1,3,3,3-hexafluoropropan-2-yl) 2-(2-methylprop-2-enoyloxy)butanedioate.
| Compound Name | bis(1,1,1,3,3,3-hexafluoropropan-2-yl) 2-(2-methylprop-2-enoyloxy)butanedioate |
|---|---|
| PubChem CID | 89116230 |
| Molecular Formula | C14H10F12O6 |
| Molecular Weight | 502.20 g/mol |
| Exact Mass | 502.03 |
| IUPAC Name | bis(1,1,1,3,3,3-hexafluoropropan-2-yl) 2-(2-methylprop-2-enoyloxy)butanedioate |
| SMILES | C=C(C)C(=O)OC(CC(=O)OC(C(F)(F)F)C(F)(F)F)C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H10F12O6/c1-4(2)7(28)30-5(8(29)32-10(13(21,22)23)14(24,25)26)3-6(27)31-9(11(15,16)17)12(18,19)20/h5,9-10H,1,3H2,2H3 |
| InChIKey | MVSHFVBLFSTPDG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.20 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|