C38H14N8O2 — CID 89116270
2-[2-[[4-[[1,3-bis(dicyanomethylidene)inden-2-ylidene]methyl]-2,5-dihydroxyphenyl]methylidene]-3-(dicyanomethylidene)inden-1-ylidene]propanedinitrile (PubChem CID 89116270) has the molecular formula C38H14N8O2 and a molecular weight of 614.58 g/mol. Its IUPAC name is 2-[2-[[4-[[1,3-bis(dicyanomethylidene)inden-2-ylidene]methyl]-2,5-dihydroxyphenyl]methylidene]-3-(dicyanomethylidene)inden-1-ylidene]propanedinitrile.
| Compound Name | 2-[2-[[4-[[1,3-bis(dicyanomethylidene)inden-2-ylidene]methyl]-2,5-dihydroxyphenyl]methylidene]-3-(dicyanomethylidene)inden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 89116270 |
| Molecular Formula | C38H14N8O2 |
| Molecular Weight | 614.58 g/mol |
| Exact Mass | 614.12 |
| IUPAC Name | 2-[2-[[4-[[1,3-bis(dicyanomethylidene)inden-2-ylidene]methyl]-2,5-dihydroxyphenyl]methylidene]-3-(dicyanomethylidene)inden-1-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1C(=Cc2cc(O)c(C=C3C(=C(C#N)C#N)c4ccccc4C3=C(C#N)C#N)cc2O)C(=C(C#N)C#N)c2ccccc21 |
| InChI | InChI=1S/C38H14N8O2/c39-13-23(14-40)35-27-5-1-2-6-28(27)36(24(15-41)16-42)31(35)9-21-11-34(48)22(12-33(21)47)10-32-37(25(17-43)18-44)29-7-3-4-8-30(29)38(32)26(19-45)20-46/h1-12,47-48H |
| InChIKey | UPBJGKQRJJOZHC-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 230.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.58 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|