About 2,3-dimethoxy-1,5-dimethylcyclohexene
2,3-dimethoxy-1,5-dimethylcyclohexene (PubChem CID 89116329) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is 2,3-dimethoxy-1,5-dimethylcyclohexene.
Molecular Properties
| Compound Name | 2,3-dimethoxy-1,5-dimethylcyclohexene |
| PubChem CID | 89116329 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 2,3-dimethoxy-1,5-dimethylcyclohexene |
| SMILES | COC1=C(C)CC(C)CC1OC |
| InChI | InChI=1S/C10H18O2/c1-7-5-8(2)10(12-4)9(6-7)11-3/h7,9H,5-6H2,1-4H3 |
| InChIKey | PSBDFHVHVXZKBR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dimethoxy-1,5-dimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethoxy-1,5-dimethylcyclohexene?
The IUPAC name of 2,3-dimethoxy-1,5-dimethylcyclohexene (CID 89116329) is 2,3-dimethoxy-1,5-dimethylcyclohexene.
What is the SMILES notation for 2,3-dimethoxy-1,5-dimethylcyclohexene?
The canonical SMILES for 2,3-dimethoxy-1,5-dimethylcyclohexene is COC1=C(C)CC(C)CC1OC.
What is the InChIKey of 2,3-dimethoxy-1,5-dimethylcyclohexene?
The InChIKey is PSBDFHVHVXZKBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-7-5-8(2)10(12-4)9(6-7)11-3/h7,9H,5-6H2,1-4H3.
What are the key properties of 2,3-dimethoxy-1,5-dimethylcyclohexene?
2,3-dimethoxy-1,5-dimethylcyclohexene has a molecular weight of 170.25 g/mol, XLogP of 2.35, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethoxy-1,5-dimethylcyclohexene is sourced from PubChem (CID 89116329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).