About (4R)-1,5-diethyl-4-[6-(1-methoxyethenyl)-4-prop-1-en-2-ylcyclohex-3-en-1-yl]cyclohexene
(4R)-1,5-diethyl-4-[6-(1-methoxyethenyl)-4-prop-1-en-2-ylcyclohex-3-en-1-yl]cyclohexene (PubChem CID 89116330) has the molecular formula C22H34O
and a molecular weight of 314.51 g/mol. Its IUPAC name is (4R)-1,5-diethyl-4-[6-(1-methoxyethenyl)-4-prop-1-en-2-ylcyclohex-3-en-1-yl]cyclohexene.
Molecular Properties
| Compound Name | (4R)-1,5-diethyl-4-[6-(1-methoxyethenyl)-4-prop-1-en-2-ylcyclohex-3-en-1-yl]cyclohexene |
| PubChem CID | 89116330 |
| Molecular Formula | C22H34O |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | (4R)-1,5-diethyl-4-[6-(1-methoxyethenyl)-4-prop-1-en-2-ylcyclohex-3-en-1-yl]cyclohexene |
| SMILES | C=C(C)C1=CCC([C@@H]2CC=C(CC)CC2CC)C(C(=C)OC)C1 |
| InChI | InChI=1S/C22H34O/c1-7-17-9-11-20(18(8-2)13-17)21-12-10-19(15(3)4)14-22(21)16(5)23-6/h9-10,18,20-22H,3,5,7-8,11-14H2,1-2,4,6H3/t18?,20-,21?,22?/m1/s1 |
| InChIKey | SNQUBVIKWSOACQ-WRCMFQCYSA-N |
| XLogP | 6.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R)-1,5-diethyl-4-[6-(1-methoxyethenyl)-4-prop-1-en-2-ylcyclohex-3-en-1-yl]cyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-1,5-diethyl-4-[6-(1-methoxyethenyl)-4-prop-1-en-2-ylcyclohex-3-en-1-yl]cyclohexene?
The IUPAC name of (4R)-1,5-diethyl-4-[6-(1-methoxyethenyl)-4-prop-1-en-2-ylcyclohex-3-en-1-yl]cyclohexene (CID 89116330) is (4R)-1,5-diethyl-4-[6-(1-methoxyethenyl)-4-prop-1-en-2-ylcyclohex-3-en-1-yl]cyclohexene.
What is the SMILES notation for (4R)-1,5-diethyl-4-[6-(1-methoxyethenyl)-4-prop-1-en-2-ylcyclohex-3-en-1-yl]cyclohexene?
The canonical SMILES for (4R)-1,5-diethyl-4-[6-(1-methoxyethenyl)-4-prop-1-en-2-ylcyclohex-3-en-1-yl]cyclohexene is C=C(C)C1=CCC([C@@H]2CC=C(CC)CC2CC)C(C(=C)OC)C1.
What is the InChIKey of (4R)-1,5-diethyl-4-[6-(1-methoxyethenyl)-4-prop-1-en-2-ylcyclohex-3-en-1-yl]cyclohexene?
The InChIKey is SNQUBVIKWSOACQ-WRCMFQCYSA-N. The full InChI is InChI=1S/C22H34O/c1-7-17-9-11-20(18(8-2)13-17)21-12-10-19(15(3)4)14-22(21)16(5)23-6/h9-10,18,20-22H,3,5,7-8,11-14H2,1-2,4,6H3/t18?,20-,21?,22?/m1/s1.
What are the key properties of (4R)-1,5-diethyl-4-[6-(1-methoxyethenyl)-4-prop-1-en-2-ylcyclohex-3-en-1-yl]cyclohexene?
(4R)-1,5-diethyl-4-[6-(1-methoxyethenyl)-4-prop-1-en-2-ylcyclohex-3-en-1-yl]cyclohexene has a molecular weight of 314.51 g/mol, XLogP of 6.45, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-1,5-diethyl-4-[6-(1-methoxyethenyl)-4-prop-1-en-2-ylcyclohex-3-en-1-yl]cyclohexene is sourced from PubChem (CID 89116330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).