About triethyl-[2-hydroxy-3-(2,2,3-trifluorobutoxy)propyl]azanium
triethyl-[2-hydroxy-3-(2,2,3-trifluorobutoxy)propyl]azanium (PubChem CID 89116431) has the molecular formula C13H27F3NO2+
and a molecular weight of 286.36 g/mol. Its IUPAC name is triethyl-[2-hydroxy-3-(2,2,3-trifluorobutoxy)propyl]azanium.
Molecular Properties
| Compound Name | triethyl-[2-hydroxy-3-(2,2,3-trifluorobutoxy)propyl]azanium |
| PubChem CID | 89116431 |
| Molecular Formula | C13H27F3NO2+ |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | triethyl-[2-hydroxy-3-(2,2,3-trifluorobutoxy)propyl]azanium |
| SMILES | CC[N+](CC)(CC)CC(O)COCC(F)(F)C(C)F |
| InChI | InChI=1S/C13H27F3NO2/c1-5-17(6-2,7-3)8-12(18)9-19-10-13(15,16)11(4)14/h11-12,18H,5-10H2,1-4H3/q+1 |
| InChIKey | VABGUDJMHGWBCL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[2-hydroxy-3-(2,2,3-trifluorobutoxy)propyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[2-hydroxy-3-(2,2,3-trifluorobutoxy)propyl]azanium?
The IUPAC name of triethyl-[2-hydroxy-3-(2,2,3-trifluorobutoxy)propyl]azanium (CID 89116431) is triethyl-[2-hydroxy-3-(2,2,3-trifluorobutoxy)propyl]azanium.
What is the SMILES notation for triethyl-[2-hydroxy-3-(2,2,3-trifluorobutoxy)propyl]azanium?
The canonical SMILES for triethyl-[2-hydroxy-3-(2,2,3-trifluorobutoxy)propyl]azanium is CC[N+](CC)(CC)CC(O)COCC(F)(F)C(C)F.
What is the InChIKey of triethyl-[2-hydroxy-3-(2,2,3-trifluorobutoxy)propyl]azanium?
The InChIKey is VABGUDJMHGWBCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27F3NO2/c1-5-17(6-2,7-3)8-12(18)9-19-10-13(15,16)11(4)14/h11-12,18H,5-10H2,1-4H3/q+1.
What are the key properties of triethyl-[2-hydroxy-3-(2,2,3-trifluorobutoxy)propyl]azanium?
triethyl-[2-hydroxy-3-(2,2,3-trifluorobutoxy)propyl]azanium has a molecular weight of 286.36 g/mol, XLogP of 2.23, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[2-hydroxy-3-(2,2,3-trifluorobutoxy)propyl]azanium is sourced from PubChem (CID 89116431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).