C17H31F8N2O4+ — CID 89116532
[2-hydroxy-3-(2,2,3,3-tetrafluoropropoxy)propyl]-[2-[[2-hydroxy-3-(2,2,3,3-tetrafluoropropoxy)propyl]-methylamino]ethyl]-dimethylazanium (PubChem CID 89116532) has the molecular formula C17H31F8N2O4+ and a molecular weight of 479.43 g/mol. Its IUPAC name is [2-hydroxy-3-(2,2,3,3-tetrafluoropropoxy)propyl]-[2-[[2-hydroxy-3-(2,2,3,3-tetrafluoropropoxy)propyl]-methylamino]ethyl]-dimethylazanium.
| Compound Name | [2-hydroxy-3-(2,2,3,3-tetrafluoropropoxy)propyl]-[2-[[2-hydroxy-3-(2,2,3,3-tetrafluoropropoxy)propyl]-methylamino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 89116532 |
| Molecular Formula | C17H31F8N2O4+ |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | [2-hydroxy-3-(2,2,3,3-tetrafluoropropoxy)propyl]-[2-[[2-hydroxy-3-(2,2,3,3-tetrafluoropropoxy)propyl]-methylamino]ethyl]-dimethylazanium |
| SMILES | CN(CC[N+](C)(C)CC(O)COCC(F)(F)C(F)F)CC(O)COCC(F)(F)C(F)F |
| InChI | InChI=1S/C17H31F8N2O4/c1-26(6-12(28)8-30-10-16(22,23)14(18)19)4-5-27(2,3)7-13(29)9-31-11-17(24,25)15(20)21/h12-15,28-29H,4-11H2,1-3H3/q+1 |
| InChIKey | KKNXHSHCIHTYSU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|