About 3-bromo-5-chloro-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine
3-bromo-5-chloro-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine (PubChem CID 89116539) has the molecular formula C7H6BrClN2
and a molecular weight of 233.50 g/mol. Its IUPAC name is 3-bromo-5-chloro-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 3-bromo-5-chloro-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 89116539 |
| Molecular Formula | C7H6BrClN2 |
| Molecular Weight | 233.50 g/mol |
| Exact Mass | 231.94 |
| IUPAC Name | 3-bromo-5-chloro-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine |
| SMILES | ClC1C=c2c(Br)c[nH]c2=NC1 |
| InChI | InChI=1S/C7H6BrClN2/c8-6-3-11-7-5(6)1-4(9)2-10-7/h1,3-4H,2H2,(H,10,11) |
| InChIKey | JLJLULKOSSNXFW-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.50 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-5-chloro-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-chloro-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 3-bromo-5-chloro-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine (CID 89116539) is 3-bromo-5-chloro-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 3-bromo-5-chloro-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 3-bromo-5-chloro-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine is ClC1C=c2c(Br)c[nH]c2=NC1.
What is the InChIKey of 3-bromo-5-chloro-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is JLJLULKOSSNXFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrClN2/c8-6-3-11-7-5(6)1-4(9)2-10-7/h1,3-4H,2H2,(H,10,11).
What are the key properties of 3-bromo-5-chloro-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine?
3-bromo-5-chloro-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 233.50 g/mol, XLogP of 0.80, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-chloro-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 89116539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).