C15H31N — CID 89116873
(E)-3,4,5,6,7,8-hexamethylnon-2-en-2-amine (PubChem CID 89116873) has the molecular formula C15H31N and a molecular weight of 225.42 g/mol. Its IUPAC name is (E)-3,4,5,6,7,8-hexamethylnon-2-en-2-amine.
| Compound Name | (E)-3,4,5,6,7,8-hexamethylnon-2-en-2-amine |
|---|---|
| PubChem CID | 89116873 |
| Molecular Formula | C15H31N |
| Molecular Weight | 225.42 g/mol |
| Exact Mass | 225.25 |
| IUPAC Name | (E)-3,4,5,6,7,8-hexamethylnon-2-en-2-amine |
| SMILES | C/C(N)=C(/C)C(C)C(C)C(C)C(C)C(C)C |
| InChI | InChI=1S/C15H31N/c1-9(2)10(3)11(4)12(5)13(6)14(7)15(8)16/h9-13H,16H2,1-8H3/b15-14+ |
| InChIKey | LKAPRAWPUSWNCX-CCEZHUSRSA-N |
| XLogP | 4.44 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |