C16H14ClN3OS — CID 8911690
2-(4-chlorophenyl)-N-[2-(thiophen-2-ylmethyl)pyrazol-3-yl]acetamide (PubChem CID 8911690) has the molecular formula C16H14ClN3OS and a molecular weight of 331.83 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[2-(thiophen-2-ylmethyl)pyrazol-3-yl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[2-(thiophen-2-ylmethyl)pyrazol-3-yl]acetamide |
|---|---|
| PubChem CID | 8911690 |
| Molecular Formula | C16H14ClN3OS |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[2-(thiophen-2-ylmethyl)pyrazol-3-yl]acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)Nc1ccnn1Cc1cccs1 |
| InChI | InChI=1S/C16H14ClN3OS/c17-13-5-3-12(4-6-13)10-16(21)19-15-7-8-18-20(15)11-14-2-1-9-22-14/h1-9H,10-11H2,(H,19,21) |
| InChIKey | UYWGCSRGBPGROD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |