C15H20F3N3O4S — CID 89117422
[2-(4-methylpiperazine-1-carbonyl)-4,5,6,7-tetrahydro-1H-indol-5-yl] trifluoromethanesulfonate (PubChem CID 89117422) has the molecular formula C15H20F3N3O4S and a molecular weight of 395.40 g/mol. Its IUPAC name is [2-(4-methylpiperazine-1-carbonyl)-4,5,6,7-tetrahydro-1H-indol-5-yl] trifluoromethanesulfonate.
| Compound Name | [2-(4-methylpiperazine-1-carbonyl)-4,5,6,7-tetrahydro-1H-indol-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 89117422 |
| Molecular Formula | C15H20F3N3O4S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | [2-(4-methylpiperazine-1-carbonyl)-4,5,6,7-tetrahydro-1H-indol-5-yl] trifluoromethanesulfonate |
| SMILES | CN1CCN(C(=O)c2cc3c([nH]2)CCC(OS(=O)(=O)C(F)(F)F)C3)CC1 |
| InChI | InChI=1S/C15H20F3N3O4S/c1-20-4-6-21(7-5-20)14(22)13-9-10-8-11(2-3-12(10)19-13)25-26(23,24)15(16,17)18/h9,11,19H,2-8H2,1H3 |
| InChIKey | FFAOOUPRQNFVGC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|