C23H21ClN6O4S — CID 89117442
1-[2-[[5-[(2-chloro-3-pyridinyl)oxy]-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol (PubChem CID 89117442) has the molecular formula C23H21ClN6O4S and a molecular weight of 512.98 g/mol. Its IUPAC name is 1-[2-[[5-[(2-chloro-3-pyridinyl)oxy]-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol.
| Compound Name | 1-[2-[[5-[(2-chloro-3-pyridinyl)oxy]-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 89117442 |
| Molecular Formula | C23H21ClN6O4S |
| Molecular Weight | 512.98 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | 1-[2-[[5-[(2-chloro-3-pyridinyl)oxy]-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol |
| SMILES | OCC(O)c1csc(Nc2ncc(Oc3cccnc3Cl)cc2OC2CCCc3ncncc32)n1 |
| InChI | InChI=1S/C23H21ClN6O4S/c24-21-19(5-2-6-26-21)33-13-7-20(34-18-4-1-3-15-14(18)9-25-12-28-15)22(27-8-13)30-23-29-16(11-35-23)17(32)10-31/h2,5-9,11-12,17-18,31-32H,1,3-4,10H2,(H,27,29,30) |
| InChIKey | YKDHEGLVAJCXDI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.98 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|