C9H11F — CID 89117522
(3Z,5Z)-4-fluoro-3-methylocta-1,3,5,7-tetraene (PubChem CID 89117522) has the molecular formula C9H11F and a molecular weight of 138.18 g/mol. Its IUPAC name is (3Z,5Z)-4-fluoro-3-methylocta-1,3,5,7-tetraene.
| Compound Name | (3Z,5Z)-4-fluoro-3-methylocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 89117522 |
| Molecular Formula | C9H11F |
| Molecular Weight | 138.18 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | (3Z,5Z)-4-fluoro-3-methylocta-1,3,5,7-tetraene |
| SMILES | C=C/C=C\C(F)=C(/C)C=C |
| InChI | InChI=1S/C9H11F/c1-4-6-7-9(10)8(3)5-2/h4-7H,1-2H2,3H3/b7-6-,9-8- |
| InChIKey | RAWLCJKCOXZERT-JPDBVBESSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.18 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|