C11H16Cl2N2 — CID 89117776
1-[(3Z,5E)-3,5-dichlorohepta-1,3,5-trien-4-yl]piperazine (PubChem CID 89117776) has the molecular formula C11H16Cl2N2 and a molecular weight of 247.17 g/mol. Its IUPAC name is 1-[(3Z,5E)-3,5-dichlorohepta-1,3,5-trien-4-yl]piperazine.
| Compound Name | 1-[(3Z,5E)-3,5-dichlorohepta-1,3,5-trien-4-yl]piperazine |
|---|---|
| PubChem CID | 89117776 |
| Molecular Formula | C11H16Cl2N2 |
| Molecular Weight | 247.17 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 1-[(3Z,5E)-3,5-dichlorohepta-1,3,5-trien-4-yl]piperazine |
| SMILES | C=C/C(Cl)=C(C(\Cl)=C/C)/N1CCNCC1 |
| InChI | InChI=1S/C11H16Cl2N2/c1-3-9(12)11(10(13)4-2)15-7-5-14-6-8-15/h3-4,14H,1,5-8H2,2H3/b10-4+,11-9- |
| InChIKey | DTFIZDKLNJDNLX-CEOLGQRUSA-N |
| XLogP | 2.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.17 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|