C12H18Cl2N2 — CID 89117777
1-[(3Z,5E)-3,5-dichlorohepta-1,3,5-trien-4-yl]-4-methylpiperazine (PubChem CID 89117777) has the molecular formula C12H18Cl2N2 and a molecular weight of 261.20 g/mol. Its IUPAC name is 1-[(3Z,5E)-3,5-dichlorohepta-1,3,5-trien-4-yl]-4-methylpiperazine.
| Compound Name | 1-[(3Z,5E)-3,5-dichlorohepta-1,3,5-trien-4-yl]-4-methylpiperazine |
|---|---|
| PubChem CID | 89117777 |
| Molecular Formula | C12H18Cl2N2 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 1-[(3Z,5E)-3,5-dichlorohepta-1,3,5-trien-4-yl]-4-methylpiperazine |
| SMILES | C=C/C(Cl)=C(C(\Cl)=C/C)/N1CCN(C)CC1 |
| InChI | InChI=1S/C12H18Cl2N2/c1-4-10(13)12(11(14)5-2)16-8-6-15(3)7-9-16/h4-5H,1,6-9H2,2-3H3/b11-5+,12-10- |
| InChIKey | HYXNKEWPKGBNET-DDLJDJBVSA-N |
| XLogP | 3.01 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|