C13H22Cl2N2 — CID 89117794
N'-[(3Z,5E)-3,5-dichlorohepta-1,3,5-trien-4-yl]-N-ethyl-N,N'-dimethylethane-1,2-diamine (PubChem CID 89117794) has the molecular formula C13H22Cl2N2 and a molecular weight of 277.24 g/mol. Its IUPAC name is N'-[(3Z,5E)-3,5-dichlorohepta-1,3,5-trien-4-yl]-N-ethyl-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-[(3Z,5E)-3,5-dichlorohepta-1,3,5-trien-4-yl]-N-ethyl-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 89117794 |
| Molecular Formula | C13H22Cl2N2 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | N'-[(3Z,5E)-3,5-dichlorohepta-1,3,5-trien-4-yl]-N-ethyl-N,N'-dimethylethane-1,2-diamine |
| SMILES | C=C/C(Cl)=C(C(\Cl)=C/C)/N(C)CCN(C)CC |
| InChI | InChI=1S/C13H22Cl2N2/c1-6-11(14)13(12(15)7-2)17(5)10-9-16(4)8-3/h6-7H,1,8-10H2,2-5H3/b12-7+,13-11- |
| InChIKey | HYVVAGGNTZQAEN-MHUJIAIDSA-N |
| XLogP | 3.65 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|