About 2,4-dimethyl-3H-1,2-thiazole
2,4-dimethyl-3H-1,2-thiazole (PubChem CID 89118035) has the molecular formula C5H9NS
and a molecular weight of 115.20 g/mol. Its IUPAC name is 2,4-dimethyl-3H-1,2-thiazole.
Molecular Properties
| Compound Name | 2,4-dimethyl-3H-1,2-thiazole |
| PubChem CID | 89118035 |
| Molecular Formula | C5H9NS |
| Molecular Weight | 115.20 g/mol |
| Exact Mass | 115.05 |
| IUPAC Name | 2,4-dimethyl-3H-1,2-thiazole |
| SMILES | CC1=CSN(C)C1 |
| InChI | InChI=1S/C5H9NS/c1-5-3-6(2)7-4-5/h4H,3H2,1-2H3 |
| InChIKey | WHFVNYXQPFIKEZ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethyl-3H-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-3H-1,2-thiazole?
The IUPAC name of 2,4-dimethyl-3H-1,2-thiazole (CID 89118035) is 2,4-dimethyl-3H-1,2-thiazole.
What is the SMILES notation for 2,4-dimethyl-3H-1,2-thiazole?
The canonical SMILES for 2,4-dimethyl-3H-1,2-thiazole is CC1=CSN(C)C1.
What is the InChIKey of 2,4-dimethyl-3H-1,2-thiazole?
The InChIKey is WHFVNYXQPFIKEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NS/c1-5-3-6(2)7-4-5/h4H,3H2,1-2H3.
What are the key properties of 2,4-dimethyl-3H-1,2-thiazole?
2,4-dimethyl-3H-1,2-thiazole has a molecular weight of 115.20 g/mol, XLogP of 1.48, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-3H-1,2-thiazole is sourced from PubChem (CID 89118035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).