C7H10O2 — CID 89118213
buta-1,3-dien-2-yl propanoate (PubChem CID 89118213) has the molecular formula C7H10O2 and a molecular weight of 126.15 g/mol. Its IUPAC name is buta-1,3-dien-2-yl propanoate.
| Compound Name | buta-1,3-dien-2-yl propanoate |
|---|---|
| PubChem CID | 89118213 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | buta-1,3-dien-2-yl propanoate |
| SMILES | C=CC(=C)OC(=O)CC |
| InChI | InChI=1S/C7H10O2/c1-4-6(3)9-7(8)5-2/h4H,1,3,5H2,2H3 |
| InChIKey | QEJSNCSPAJUPGH-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|