C34H27N5O6 — CID 89118254
[3-[5-[(5-formamido-1H-indole-2-carbonyl)amino]-1H-indole-2-carbonyl]-1-(hydroxymethyl)-1,2-dihydrobenzo[e]indol-5-yl] acetate (PubChem CID 89118254) has the molecular formula C34H27N5O6 and a molecular weight of 601.62 g/mol. Its IUPAC name is [3-[5-[(5-formamido-1H-indole-2-carbonyl)amino]-1H-indole-2-carbonyl]-1-(hydroxymethyl)-1,2-dihydrobenzo[e]indol-5-yl] acetate.
| Compound Name | [3-[5-[(5-formamido-1H-indole-2-carbonyl)amino]-1H-indole-2-carbonyl]-1-(hydroxymethyl)-1,2-dihydrobenzo[e]indol-5-yl] acetate |
|---|---|
| PubChem CID | 89118254 |
| Molecular Formula | C34H27N5O6 |
| Molecular Weight | 601.62 g/mol |
| Exact Mass | 601.20 |
| IUPAC Name | [3-[5-[(5-formamido-1H-indole-2-carbonyl)amino]-1H-indole-2-carbonyl]-1-(hydroxymethyl)-1,2-dihydrobenzo[e]indol-5-yl] acetate |
| SMILES | CC(=O)Oc1cc2c(c3ccccc13)C(CO)CN2C(=O)c1cc2cc(NC(=O)c3cc4cc(NC=O)ccc4[nH]3)ccc2[nH]1 |
| InChI | InChI=1S/C34H27N5O6/c1-18(42)45-31-14-30-32(25-5-3-2-4-24(25)31)21(16-40)15-39(30)34(44)29-13-20-11-23(7-9-27(20)38-29)36-33(43)28-12-19-10-22(35-17-41)6-8-26(19)37-28/h2-14,17,21,37-38,40H,15-16H2,1H3,(H,35,41)(H,36,43) |
| InChIKey | HIRVOCVXWDKLMO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 156.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.62 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|