C10H16N2 — CID 89118333
[(2E,4Z)-2,6-dimethylocta-2,4,6,7-tetraenyl]hydrazine (PubChem CID 89118333) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is [(2E,4Z)-2,6-dimethylocta-2,4,6,7-tetraenyl]hydrazine.
| Compound Name | [(2E,4Z)-2,6-dimethylocta-2,4,6,7-tetraenyl]hydrazine |
|---|---|
| PubChem CID | 89118333 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | [(2E,4Z)-2,6-dimethylocta-2,4,6,7-tetraenyl]hydrazine |
| SMILES | C=C=C(C)/C=C\C=C(/C)CNN |
| InChI | InChI=1S/C10H16N2/c1-4-9(2)6-5-7-10(3)8-12-11/h5-7,12H,1,8,11H2,2-3H3/b6-5-,10-7+ |
| InChIKey | RWQYYPXBOBBNCF-ZZWPSLBBSA-N |
| XLogP | 1.68 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|