About N-methoxy-N'-methylpropanimidamide
N-methoxy-N'-methylpropanimidamide (PubChem CID 89118421) has the molecular formula C5H12N2O
and a molecular weight of 116.16 g/mol. Its IUPAC name is N-methoxy-N'-methylpropanimidamide.
Molecular Properties
| Compound Name | N-methoxy-N'-methylpropanimidamide |
| PubChem CID | 89118421 |
| Molecular Formula | C5H12N2O |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.09 |
| IUPAC Name | N-methoxy-N'-methylpropanimidamide |
| SMILES | CC/C(=N\C)NOC |
| InChI | InChI=1S/C5H12N2O/c1-4-5(6-2)7-8-3/h4H2,1-3H3,(H,6,7) |
| InChIKey | VWHRBLVFWSATCC-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-N'-methylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-N'-methylpropanimidamide?
The IUPAC name of N-methoxy-N'-methylpropanimidamide (CID 89118421) is N-methoxy-N'-methylpropanimidamide.
What is the SMILES notation for N-methoxy-N'-methylpropanimidamide?
The canonical SMILES for N-methoxy-N'-methylpropanimidamide is CC/C(=N\C)NOC.
What is the InChIKey of N-methoxy-N'-methylpropanimidamide?
The InChIKey is VWHRBLVFWSATCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O/c1-4-5(6-2)7-8-3/h4H2,1-3H3,(H,6,7).
What are the key properties of N-methoxy-N'-methylpropanimidamide?
N-methoxy-N'-methylpropanimidamide has a molecular weight of 116.16 g/mol, XLogP of 0.58, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-N'-methylpropanimidamide is sourced from PubChem (CID 89118421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).