About N-[[1-butan-2-yl-4-(2,2-difluoroethyl)piperazin-2-yl]methyl]-N-tert-butylmethanesulfonamide
N-[[1-butan-2-yl-4-(2,2-difluoroethyl)piperazin-2-yl]methyl]-N-tert-butylmethanesulfonamide (PubChem CID 89118451) has the molecular formula C16H33F2N3O2S
and a molecular weight of 369.52 g/mol. Its IUPAC name is N-[[1-butan-2-yl-4-(2,2-difluoroethyl)piperazin-2-yl]methyl]-N-tert-butylmethanesulfonamide.
Molecular Properties
| Compound Name | N-[[1-butan-2-yl-4-(2,2-difluoroethyl)piperazin-2-yl]methyl]-N-tert-butylmethanesulfonamide |
| PubChem CID | 89118451 |
| Molecular Formula | C16H33F2N3O2S |
| Molecular Weight | 369.52 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | N-[[1-butan-2-yl-4-(2,2-difluoroethyl)piperazin-2-yl]methyl]-N-tert-butylmethanesulfonamide |
| SMILES | CCC(C)N1CCN(CC(F)F)CC1CN(C(C)(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C16H33F2N3O2S/c1-7-13(2)20-9-8-19(12-15(17)18)10-14(20)11-21(16(3,4)5)24(6,22)23/h13-15H,7-12H2,1-6H3 |
| InChIKey | CSGMYHFCLWRVBM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.52 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[1-butan-2-yl-4-(2,2-difluoroethyl)piperazin-2-yl]methyl]-N-tert-butylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-butan-2-yl-4-(2,2-difluoroethyl)piperazin-2-yl]methyl]-N-tert-butylmethanesulfonamide?
The IUPAC name of N-[[1-butan-2-yl-4-(2,2-difluoroethyl)piperazin-2-yl]methyl]-N-tert-butylmethanesulfonamide (CID 89118451) is N-[[1-butan-2-yl-4-(2,2-difluoroethyl)piperazin-2-yl]methyl]-N-tert-butylmethanesulfonamide.
What is the SMILES notation for N-[[1-butan-2-yl-4-(2,2-difluoroethyl)piperazin-2-yl]methyl]-N-tert-butylmethanesulfonamide?
The canonical SMILES for N-[[1-butan-2-yl-4-(2,2-difluoroethyl)piperazin-2-yl]methyl]-N-tert-butylmethanesulfonamide is CCC(C)N1CCN(CC(F)F)CC1CN(C(C)(C)C)S(C)(=O)=O.
What is the InChIKey of N-[[1-butan-2-yl-4-(2,2-difluoroethyl)piperazin-2-yl]methyl]-N-tert-butylmethanesulfonamide?
The InChIKey is CSGMYHFCLWRVBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33F2N3O2S/c1-7-13(2)20-9-8-19(12-15(17)18)10-14(20)11-21(16(3,4)5)24(6,22)23/h13-15H,7-12H2,1-6H3.
What are the key properties of N-[[1-butan-2-yl-4-(2,2-difluoroethyl)piperazin-2-yl]methyl]-N-tert-butylmethanesulfonamide?
N-[[1-butan-2-yl-4-(2,2-difluoroethyl)piperazin-2-yl]methyl]-N-tert-butylmethanesulfonamide has a molecular weight of 369.52 g/mol, XLogP of 2.10, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-butan-2-yl-4-(2,2-difluoroethyl)piperazin-2-yl]methyl]-N-tert-butylmethanesulfonamide is sourced from PubChem (CID 89118451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).