C23H31BN2O3S — CID 89119201
CID 89119201 (PubChem CID 89119201) has the molecular formula C23H31BN2O3S and a molecular weight of 426.39 g/mol.
| Compound Name | CID 89119201 |
|---|---|
| PubChem CID | 89119201 |
| Molecular Formula | C23H31BN2O3S |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | — |
| SMILES | [B]c1cccc(S(=O)(=O)N(C)CC(O)CNC(C)(C)CC2Cc3ccccc3C2)c1 |
| InChI | InChI=1S/C23H31BN2O3S/c1-23(2,14-17-11-18-7-4-5-8-19(18)12-17)25-15-21(27)16-26(3)30(28,29)22-10-6-9-20(24)13-22/h4-10,13,17,21,25,27H,11-12,14-16H2,1-3H3 |
| InChIKey | OJVUUQAOZIEAJV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|