About 2-fluoro-N,4-dimethyl-N-[[(2S)-oxiran-2-yl]methyl]benzenesulfonamide
2-fluoro-N,4-dimethyl-N-[[(2S)-oxiran-2-yl]methyl]benzenesulfonamide (PubChem CID 89119219) has the molecular formula C11H14FNO3S
and a molecular weight of 259.30 g/mol. Its IUPAC name is 2-fluoro-N,4-dimethyl-N-[[(2S)-oxiran-2-yl]methyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 2-fluoro-N,4-dimethyl-N-[[(2S)-oxiran-2-yl]methyl]benzenesulfonamide |
| PubChem CID | 89119219 |
| Molecular Formula | C11H14FNO3S |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2-fluoro-N,4-dimethyl-N-[[(2S)-oxiran-2-yl]methyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C[C@H]2CO2)c(F)c1 |
| InChI | InChI=1S/C11H14FNO3S/c1-8-3-4-11(10(12)5-8)17(14,15)13(2)6-9-7-16-9/h3-5,9H,6-7H2,1-2H3/t9-/m0/s1 |
| InChIKey | AJUZWBHPWZYLEU-VIFPVBQESA-N |
| XLogP | 1.15 |
| TPSA | 49.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N,4-dimethyl-N-[[(2S)-oxiran-2-yl]methyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N,4-dimethyl-N-[[(2S)-oxiran-2-yl]methyl]benzenesulfonamide?
The IUPAC name of 2-fluoro-N,4-dimethyl-N-[[(2S)-oxiran-2-yl]methyl]benzenesulfonamide (CID 89119219) is 2-fluoro-N,4-dimethyl-N-[[(2S)-oxiran-2-yl]methyl]benzenesulfonamide.
What is the SMILES notation for 2-fluoro-N,4-dimethyl-N-[[(2S)-oxiran-2-yl]methyl]benzenesulfonamide?
The canonical SMILES for 2-fluoro-N,4-dimethyl-N-[[(2S)-oxiran-2-yl]methyl]benzenesulfonamide is Cc1ccc(S(=O)(=O)N(C)C[C@H]2CO2)c(F)c1.
What is the InChIKey of 2-fluoro-N,4-dimethyl-N-[[(2S)-oxiran-2-yl]methyl]benzenesulfonamide?
The InChIKey is AJUZWBHPWZYLEU-VIFPVBQESA-N. The full InChI is InChI=1S/C11H14FNO3S/c1-8-3-4-11(10(12)5-8)17(14,15)13(2)6-9-7-16-9/h3-5,9H,6-7H2,1-2H3/t9-/m0/s1.
What are the key properties of 2-fluoro-N,4-dimethyl-N-[[(2S)-oxiran-2-yl]methyl]benzenesulfonamide?
2-fluoro-N,4-dimethyl-N-[[(2S)-oxiran-2-yl]methyl]benzenesulfonamide has a molecular weight of 259.30 g/mol, XLogP of 1.15, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N,4-dimethyl-N-[[(2S)-oxiran-2-yl]methyl]benzenesulfonamide is sourced from PubChem (CID 89119219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).