C34H45F3N2O2 — CID 89119563
(1S,4S,5R,13R,17R)-4,5,9,9,13,20,20-heptamethyl-16-methylidene-10,23-dioxo-24-(2,2,2-trifluoroethyl)-24-azahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracos-11-ene-11-carbonitrile (PubChem CID 89119563) has the molecular formula C34H45F3N2O2 and a molecular weight of 570.74 g/mol. Its IUPAC name is (1S,4S,5R,13R,17R)-4,5,9,9,13,20,20-heptamethyl-16-methylidene-10,23-dioxo-24-(2,2,2-trifluoroethyl)-24-azahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracos-11-ene-11-carbonitrile.
| Compound Name | (1S,4S,5R,13R,17R)-4,5,9,9,13,20,20-heptamethyl-16-methylidene-10,23-dioxo-24-(2,2,2-trifluoroethyl)-24-azahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracos-11-ene-11-carbonitrile |
|---|---|
| PubChem CID | 89119563 |
| Molecular Formula | C34H45F3N2O2 |
| Molecular Weight | 570.74 g/mol |
| Exact Mass | 570.34 |
| IUPAC Name | (1S,4S,5R,13R,17R)-4,5,9,9,13,20,20-heptamethyl-16-methylidene-10,23-dioxo-24-(2,2,2-trifluoroethyl)-24-azahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracos-11-ene-11-carbonitrile |
| SMILES | C=C1CC2[C@@]3(C)C=C(C#N)C(=O)C(C)(C)C3CC[C@@]2(C)[C@]2(C)CC[C@@]34CCC(C)(C)CC3[C@@]12N(CC(F)(F)F)C4=O |
| InChI | InChI=1S/C34H45F3N2O2/c1-20-15-23-29(6)16-21(18-38)25(40)28(4,5)22(29)9-10-30(23,7)31(8)12-14-32-13-11-27(2,3)17-24(32)34(20,31)39(26(32)41)19-33(35,36)37/h16,22-24H,1,9-15,17,19H2,2-8H3/t22?,23?,24?,29-,30+,31-,32-,34-/m0/s1 |
| InChIKey | BEHFZWDTXNEEAU-ALHRROGCSA-N |
| XLogP | 7.80 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.74 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|