C11H15F3O — CID 89119642
(3S,5E)-2-methyl-6-(trifluoromethyl)nona-1,5,8-trien-3-ol (PubChem CID 89119642) has the molecular formula C11H15F3O and a molecular weight of 220.23 g/mol. Its IUPAC name is (3S,5E)-2-methyl-6-(trifluoromethyl)nona-1,5,8-trien-3-ol.
| Compound Name | (3S,5E)-2-methyl-6-(trifluoromethyl)nona-1,5,8-trien-3-ol |
|---|---|
| PubChem CID | 89119642 |
| Molecular Formula | C11H15F3O |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (3S,5E)-2-methyl-6-(trifluoromethyl)nona-1,5,8-trien-3-ol |
| SMILES | C=CC/C(=C\C[C@H](O)C(=C)C)C(F)(F)F |
| InChI | InChI=1S/C11H15F3O/c1-4-5-9(11(12,13)14)6-7-10(15)8(2)3/h4,6,10,15H,1-2,5,7H2,3H3/b9-6+/t10-/m0/s1 |
| InChIKey | ILZXDYOSEPDQAE-ZKXNXJMVSA-N |
| XLogP | 3.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|