C11H8N2 — CID 89119661
3,13-diazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaene (PubChem CID 89119661) has the molecular formula C11H8N2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 3,13-diazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaene.
| Compound Name | 3,13-diazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 89119661 |
| Molecular Formula | C11H8N2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 3,13-diazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaene |
| SMILES | C1=CC2=CC=CC3=CN=CC(=C1)N23 |
| InChI | InChI=1S/C11H8N2/c1-3-9-4-2-6-11-8-12-7-10(5-1)13(9)11/h1-8H |
| InChIKey | BKLCRMLKOSGONJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |