C21H33F3N4O2 — CID 89119692
(3E,5Z)-6-amino-N-[[1-[2-(2,2-dimethylpropanoylamino)ethyl]piperidin-4-yl]methyl]-2-methylidene-4-(trifluoromethyl)hexa-3,5-dienamide (PubChem CID 89119692) has the molecular formula C21H33F3N4O2 and a molecular weight of 430.52 g/mol. Its IUPAC name is (3E,5Z)-6-amino-N-[[1-[2-(2,2-dimethylpropanoylamino)ethyl]piperidin-4-yl]methyl]-2-methylidene-4-(trifluoromethyl)hexa-3,5-dienamide.
| Compound Name | (3E,5Z)-6-amino-N-[[1-[2-(2,2-dimethylpropanoylamino)ethyl]piperidin-4-yl]methyl]-2-methylidene-4-(trifluoromethyl)hexa-3,5-dienamide |
|---|---|
| PubChem CID | 89119692 |
| Molecular Formula | C21H33F3N4O2 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | (3E,5Z)-6-amino-N-[[1-[2-(2,2-dimethylpropanoylamino)ethyl]piperidin-4-yl]methyl]-2-methylidene-4-(trifluoromethyl)hexa-3,5-dienamide |
| SMILES | C=C(/C=C(\C=C/N)C(F)(F)F)C(=O)NCC1CCN(CCNC(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C21H33F3N4O2/c1-15(13-17(5-8-25)21(22,23)24)18(29)27-14-16-6-10-28(11-7-16)12-9-26-19(30)20(2,3)4/h5,8,13,16H,1,6-7,9-12,14,25H2,2-4H3,(H,26,30)(H,27,29)/b8-5-,17-13+ |
| InChIKey | FLUUQEHMBPEDQV-KERZFVRCSA-N |
| XLogP | 2.49 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|