About 2-[4-[[1-[3,5-bis(trifluoromethyl)phenyl]ethenylamino]methyl]piperidin-1-yl]acetonitrile
2-[4-[[1-[3,5-bis(trifluoromethyl)phenyl]ethenylamino]methyl]piperidin-1-yl]acetonitrile (PubChem CID 89119758) has the molecular formula C18H19F6N3
and a molecular weight of 391.36 g/mol. Its IUPAC name is 2-[4-[[1-[3,5-bis(trifluoromethyl)phenyl]ethenylamino]methyl]piperidin-1-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[4-[[1-[3,5-bis(trifluoromethyl)phenyl]ethenylamino]methyl]piperidin-1-yl]acetonitrile |
| PubChem CID | 89119758 |
| Molecular Formula | C18H19F6N3 |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 2-[4-[[1-[3,5-bis(trifluoromethyl)phenyl]ethenylamino]methyl]piperidin-1-yl]acetonitrile |
| SMILES | C=C(NCC1CCN(CC#N)CC1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H19F6N3/c1-12(26-11-13-2-5-27(6-3-13)7-4-25)14-8-15(17(19,20)21)10-16(9-14)18(22,23)24/h8-10,13,26H,1-3,5-7,11H2 |
| InChIKey | IFBPYHIWKBWIFC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[[1-[3,5-bis(trifluoromethyl)phenyl]ethenylamino]methyl]piperidin-1-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[[1-[3,5-bis(trifluoromethyl)phenyl]ethenylamino]methyl]piperidin-1-yl]acetonitrile?
The IUPAC name of 2-[4-[[1-[3,5-bis(trifluoromethyl)phenyl]ethenylamino]methyl]piperidin-1-yl]acetonitrile (CID 89119758) is 2-[4-[[1-[3,5-bis(trifluoromethyl)phenyl]ethenylamino]methyl]piperidin-1-yl]acetonitrile.
What is the SMILES notation for 2-[4-[[1-[3,5-bis(trifluoromethyl)phenyl]ethenylamino]methyl]piperidin-1-yl]acetonitrile?
The canonical SMILES for 2-[4-[[1-[3,5-bis(trifluoromethyl)phenyl]ethenylamino]methyl]piperidin-1-yl]acetonitrile is C=C(NCC1CCN(CC#N)CC1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 2-[4-[[1-[3,5-bis(trifluoromethyl)phenyl]ethenylamino]methyl]piperidin-1-yl]acetonitrile?
The InChIKey is IFBPYHIWKBWIFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19F6N3/c1-12(26-11-13-2-5-27(6-3-13)7-4-25)14-8-15(17(19,20)21)10-16(9-14)18(22,23)24/h8-10,13,26H,1-3,5-7,11H2.
What are the key properties of 2-[4-[[1-[3,5-bis(trifluoromethyl)phenyl]ethenylamino]methyl]piperidin-1-yl]acetonitrile?
2-[4-[[1-[3,5-bis(trifluoromethyl)phenyl]ethenylamino]methyl]piperidin-1-yl]acetonitrile has a molecular weight of 391.36 g/mol, XLogP of 4.52, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[[1-[3,5-bis(trifluoromethyl)phenyl]ethenylamino]methyl]piperidin-1-yl]acetonitrile is sourced from PubChem (CID 89119758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).