C31H37N5O — CID 89119966
(3Z,5Z)-6-amino-N-[3-amino-2-ethenyl-5-(1H-indol-4-yl)phenyl]-7-(3,3-dimethylpiperidin-1-yl)-2-methylidenehepta-3,5-dienamide (PubChem CID 89119966) has the molecular formula C31H37N5O and a molecular weight of 495.67 g/mol. Its IUPAC name is (3Z,5Z)-6-amino-N-[3-amino-2-ethenyl-5-(1H-indol-4-yl)phenyl]-7-(3,3-dimethylpiperidin-1-yl)-2-methylidenehepta-3,5-dienamide.
| Compound Name | (3Z,5Z)-6-amino-N-[3-amino-2-ethenyl-5-(1H-indol-4-yl)phenyl]-7-(3,3-dimethylpiperidin-1-yl)-2-methylidenehepta-3,5-dienamide |
|---|---|
| PubChem CID | 89119966 |
| Molecular Formula | C31H37N5O |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.30 |
| IUPAC Name | (3Z,5Z)-6-amino-N-[3-amino-2-ethenyl-5-(1H-indol-4-yl)phenyl]-7-(3,3-dimethylpiperidin-1-yl)-2-methylidenehepta-3,5-dienamide |
| SMILES | C=Cc1c(N)cc(-c2cccc3[nH]ccc23)cc1NC(=O)C(=C)/C=C\C=C(/N)CN1CCCC(C)(C)C1 |
| InChI | InChI=1S/C31H37N5O/c1-5-24-27(33)17-22(25-11-7-12-28-26(25)13-15-34-28)18-29(24)35-30(37)21(2)9-6-10-23(32)19-36-16-8-14-31(3,4)20-36/h5-7,9-13,15,17-18,34H,1-2,8,14,16,19-20,32-33H2,3-4H3,(H,35,37)/b9-6-,23-10- |
| InChIKey | FMIKNZUCPSKQAK-ODBCMADUSA-N |
| XLogP | 6.08 |
| TPSA | 100.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|