About 2,3-diamino-3-imino-N,2-dimethylpropanamide
2,3-diamino-3-imino-N,2-dimethylpropanamide (PubChem CID 89120057) has the molecular formula C5H12N4O
and a molecular weight of 144.18 g/mol. Its IUPAC name is 2,3-diamino-3-imino-N,2-dimethylpropanamide.
Molecular Properties
| Compound Name | 2,3-diamino-3-imino-N,2-dimethylpropanamide |
| PubChem CID | 89120057 |
| Molecular Formula | C5H12N4O |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | 2,3-diamino-3-imino-N,2-dimethylpropanamide |
| SMILES | [H]/N=C(\N)C(C)(N)C(=O)NC |
| InChI | InChI=1S/C5H12N4O/c1-5(8,3(6)7)4(10)9-2/h8H2,1-2H3,(H3,6,7)(H,9,10) |
| InChIKey | VMBXDAUHPUMWJN-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 104.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diamino-3-imino-N,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diamino-3-imino-N,2-dimethylpropanamide?
The IUPAC name of 2,3-diamino-3-imino-N,2-dimethylpropanamide (CID 89120057) is 2,3-diamino-3-imino-N,2-dimethylpropanamide.
What is the SMILES notation for 2,3-diamino-3-imino-N,2-dimethylpropanamide?
The canonical SMILES for 2,3-diamino-3-imino-N,2-dimethylpropanamide is [H]/N=C(\N)C(C)(N)C(=O)NC.
What is the InChIKey of 2,3-diamino-3-imino-N,2-dimethylpropanamide?
The InChIKey is VMBXDAUHPUMWJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N4O/c1-5(8,3(6)7)4(10)9-2/h8H2,1-2H3,(H3,6,7)(H,9,10).
What are the key properties of 2,3-diamino-3-imino-N,2-dimethylpropanamide?
2,3-diamino-3-imino-N,2-dimethylpropanamide has a molecular weight of 144.18 g/mol, XLogP of -1.61, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diamino-3-imino-N,2-dimethylpropanamide is sourced from PubChem (CID 89120057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).