About 2-[[5-(iodoamino)-8-methyl-7-oxo-2,3-dihydroimidazo[1,2-a]pyrimidin-6-yl]amino]acetamide
2-[[5-(iodoamino)-8-methyl-7-oxo-2,3-dihydroimidazo[1,2-a]pyrimidin-6-yl]amino]acetamide (PubChem CID 89120109) has the molecular formula C9H13IN6O2
and a molecular weight of 364.15 g/mol. Its IUPAC name is 2-[[5-(iodoamino)-8-methyl-7-oxo-2,3-dihydroimidazo[1,2-a]pyrimidin-6-yl]amino]acetamide.
Molecular Properties
| Compound Name | 2-[[5-(iodoamino)-8-methyl-7-oxo-2,3-dihydroimidazo[1,2-a]pyrimidin-6-yl]amino]acetamide |
| PubChem CID | 89120109 |
| Molecular Formula | C9H13IN6O2 |
| Molecular Weight | 364.15 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 2-[[5-(iodoamino)-8-methyl-7-oxo-2,3-dihydroimidazo[1,2-a]pyrimidin-6-yl]amino]acetamide |
| SMILES | CN1C(=O)C(NCC(N)=O)=C(NI)N2CCN=C12 |
| InChI | InChI=1S/C9H13IN6O2/c1-15-8(18)6(13-4-5(11)17)7(14-10)16-3-2-12-9(15)16/h13-14H,2-4H2,1H3,(H2,11,17) |
| InChIKey | HAKHIBHNMHRZDT-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.15 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-[[5-(iodoamino)-8-methyl-7-oxo-2,3-dihydroimidazo[1,2-a]pyrimidin-6-yl]amino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(iodoamino)-8-methyl-7-oxo-2,3-dihydroimidazo[1,2-a]pyrimidin-6-yl]amino]acetamide?
The IUPAC name of 2-[[5-(iodoamino)-8-methyl-7-oxo-2,3-dihydroimidazo[1,2-a]pyrimidin-6-yl]amino]acetamide (CID 89120109) is 2-[[5-(iodoamino)-8-methyl-7-oxo-2,3-dihydroimidazo[1,2-a]pyrimidin-6-yl]amino]acetamide.
What is the SMILES notation for 2-[[5-(iodoamino)-8-methyl-7-oxo-2,3-dihydroimidazo[1,2-a]pyrimidin-6-yl]amino]acetamide?
The canonical SMILES for 2-[[5-(iodoamino)-8-methyl-7-oxo-2,3-dihydroimidazo[1,2-a]pyrimidin-6-yl]amino]acetamide is CN1C(=O)C(NCC(N)=O)=C(NI)N2CCN=C12.
What is the InChIKey of 2-[[5-(iodoamino)-8-methyl-7-oxo-2,3-dihydroimidazo[1,2-a]pyrimidin-6-yl]amino]acetamide?
The InChIKey is HAKHIBHNMHRZDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13IN6O2/c1-15-8(18)6(13-4-5(11)17)7(14-10)16-3-2-12-9(15)16/h13-14H,2-4H2,1H3,(H2,11,17).
What are the key properties of 2-[[5-(iodoamino)-8-methyl-7-oxo-2,3-dihydroimidazo[1,2-a]pyrimidin-6-yl]amino]acetamide?
2-[[5-(iodoamino)-8-methyl-7-oxo-2,3-dihydroimidazo[1,2-a]pyrimidin-6-yl]amino]acetamide has a molecular weight of 364.15 g/mol, XLogP of -1.69, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(iodoamino)-8-methyl-7-oxo-2,3-dihydroimidazo[1,2-a]pyrimidin-6-yl]amino]acetamide is sourced from PubChem (CID 89120109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).