C6H11N3 — CID 89120677
1,2,3,5,6,7-hexahydroimidazo[1,2-c]pyrimidine (PubChem CID 89120677) has the molecular formula C6H11N3 and a molecular weight of 125.17 g/mol. Its IUPAC name is 1,2,3,5,6,7-hexahydroimidazo[1,2-c]pyrimidine.
| Compound Name | 1,2,3,5,6,7-hexahydroimidazo[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 89120677 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 1,2,3,5,6,7-hexahydroimidazo[1,2-c]pyrimidine |
| SMILES | C1=C2NCCN2CNC1 |
| InChI | InChI=1S/C6H11N3/c1-2-7-5-9-4-3-8-6(1)9/h1,7-8H,2-5H2 |
| InChIKey | BOBJFXJUOGBDQD-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |