C8H11BrS — CID 89120744
2-bromo-2,3,4,5,6,7-hexahydro-1-benzothiophene (PubChem CID 89120744) has the molecular formula C8H11BrS and a molecular weight of 219.15 g/mol. Its IUPAC name is 2-bromo-2,3,4,5,6,7-hexahydro-1-benzothiophene.
| Compound Name | 2-bromo-2,3,4,5,6,7-hexahydro-1-benzothiophene |
|---|---|
| PubChem CID | 89120744 |
| Molecular Formula | C8H11BrS |
| Molecular Weight | 219.15 g/mol |
| Exact Mass | 217.98 |
| IUPAC Name | 2-bromo-2,3,4,5,6,7-hexahydro-1-benzothiophene |
| SMILES | BrC1CC2=C(CCCC2)S1 |
| InChI | InChI=1S/C8H11BrS/c9-8-5-6-3-1-2-4-7(6)10-8/h8H,1-5H2 |
| InChIKey | AZCHAMDAAKHCGF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.15 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|