C28H27N7OS — CID 89120753
O-[8-[[4-(4-amino-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)phenyl]methyl]-8-azabicyclo[3.2.1]octan-3-yl] imidazole-1-carbothioate (PubChem CID 89120753) has the molecular formula C28H27N7OS and a molecular weight of 509.64 g/mol. Its IUPAC name is O-[8-[[4-(4-amino-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)phenyl]methyl]-8-azabicyclo[3.2.1]octan-3-yl] imidazole-1-carbothioate.
| Compound Name | O-[8-[[4-(4-amino-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)phenyl]methyl]-8-azabicyclo[3.2.1]octan-3-yl] imidazole-1-carbothioate |
|---|---|
| PubChem CID | 89120753 |
| Molecular Formula | C28H27N7OS |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | O-[8-[[4-(4-amino-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)phenyl]methyl]-8-azabicyclo[3.2.1]octan-3-yl] imidazole-1-carbothioate |
| SMILES | Nc1cc2c(cn1)[nH]c1ncc(-c3ccc(CN4C5CCC4CC(OC(=S)n4ccnc4)C5)cc3)cc12 |
| InChI | InChI=1S/C28H27N7OS/c29-26-12-23-24-9-19(13-32-27(24)33-25(23)14-31-26)18-3-1-17(2-4-18)15-35-20-5-6-21(35)11-22(10-20)36-28(37)34-8-7-30-16-34/h1-4,7-9,12-14,16,20-22H,5-6,10-11,15H2,(H2,29,31)(H,32,33) |
| InChIKey | KCUSVQWUCZVSGG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 97.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|