C27H27NO9 — CID 89120860
[(2S,3S)-6-cyano-4a,8,8-trimethyl-7-oxo-2-(3,4,5-trihydroxyphenyl)-2,3,4,8a-tetrahydrochromen-3-yl] 3,4-dihydroxy-5-methylbenzoate (PubChem CID 89120860) has the molecular formula C27H27NO9 and a molecular weight of 509.51 g/mol. Its IUPAC name is [(2S,3S)-6-cyano-4a,8,8-trimethyl-7-oxo-2-(3,4,5-trihydroxyphenyl)-2,3,4,8a-tetrahydrochromen-3-yl] 3,4-dihydroxy-5-methylbenzoate.
| Compound Name | [(2S,3S)-6-cyano-4a,8,8-trimethyl-7-oxo-2-(3,4,5-trihydroxyphenyl)-2,3,4,8a-tetrahydrochromen-3-yl] 3,4-dihydroxy-5-methylbenzoate |
|---|---|
| PubChem CID | 89120860 |
| Molecular Formula | C27H27NO9 |
| Molecular Weight | 509.51 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | [(2S,3S)-6-cyano-4a,8,8-trimethyl-7-oxo-2-(3,4,5-trihydroxyphenyl)-2,3,4,8a-tetrahydrochromen-3-yl] 3,4-dihydroxy-5-methylbenzoate |
| SMILES | Cc1cc(C(=O)O[C@H]2CC3(C)C=C(C#N)C(=O)C(C)(C)C3O[C@H]2c2cc(O)c(O)c(O)c2)cc(O)c1O |
| InChI | InChI=1S/C27H27NO9/c1-12-5-14(8-16(29)20(12)32)24(35)36-19-10-27(4)9-15(11-28)23(34)26(2,3)25(27)37-22(19)13-6-17(30)21(33)18(31)7-13/h5-9,19,22,25,29-33H,10H2,1-4H3/t19-,22-,25?,27?/m0/s1 |
| InChIKey | QGZMPKVKRZNQOQ-PDPJLDCLSA-N |
| XLogP | 3.64 |
| TPSA | 177.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|