C16H19NO5 — CID 89121053
ethenyl 3-[[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]carbonylamino]propanoate (PubChem CID 89121053) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is ethenyl 3-[[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]carbonylamino]propanoate.
| Compound Name | ethenyl 3-[[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]carbonylamino]propanoate |
|---|---|
| PubChem CID | 89121053 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | ethenyl 3-[[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]carbonylamino]propanoate |
| SMILES | C=COC(=O)CCNC(=O)Oc1ccc(/C=C/C)cc1OC |
| InChI | InChI=1S/C16H19NO5/c1-4-6-12-7-8-13(14(11-12)20-3)22-16(19)17-10-9-15(18)21-5-2/h4-8,11H,2,9-10H2,1,3H3,(H,17,19)/b6-4+ |
| InChIKey | KIACWBJYVIRBKJ-GQCTYLIASA-N |
| XLogP | 2.89 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|