C26H43N3O11 — CID 89121093
5-O-tert-butyl 1-O-[2-hydroxy-3-[3-(2-hydroxy-4,4-dimethylhexyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 2,3-dihydroxypentanedioate (PubChem CID 89121093) has the molecular formula C26H43N3O11 and a molecular weight of 573.64 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-[2-hydroxy-3-[3-(2-hydroxy-4,4-dimethylhexyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 2,3-dihydroxypentanedioate.
| Compound Name | 5-O-tert-butyl 1-O-[2-hydroxy-3-[3-(2-hydroxy-4,4-dimethylhexyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 2,3-dihydroxypentanedioate |
|---|---|
| PubChem CID | 89121093 |
| Molecular Formula | C26H43N3O11 |
| Molecular Weight | 573.64 g/mol |
| Exact Mass | 573.29 |
| IUPAC Name | 5-O-tert-butyl 1-O-[2-hydroxy-3-[3-(2-hydroxy-4,4-dimethylhexyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 2,3-dihydroxypentanedioate |
| SMILES | C=CCn1c(=O)n(CC(O)COC(=O)C(O)C(O)CC(=O)OC(C)(C)C)c(=O)n(CC(O)CC(C)(C)CC)c1=O |
| InChI | InChI=1S/C26H43N3O11/c1-8-10-27-22(36)28(13-16(30)12-26(6,7)9-2)24(38)29(23(27)37)14-17(31)15-39-21(35)20(34)18(32)11-19(33)40-25(3,4)5/h8,16-18,20,30-32,34H,1,9-15H2,2-7H3 |
| InChIKey | SJGWISCICCZQQY-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 199.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.64 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|