C28H47N3O12 — CID 89121095
1-O-[3-[3-(4-ethyl-2-hydroxy-4-methylhexyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]-2-hydroxypropyl] 5-O-(2-methylbutan-2-yl) 2,3,4-trihydroxypentanedioate (PubChem CID 89121095) has the molecular formula C28H47N3O12 and a molecular weight of 617.69 g/mol. Its IUPAC name is 1-O-[3-[3-(4-ethyl-2-hydroxy-4-methylhexyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]-2-hydroxypropyl] 5-O-(2-methylbutan-2-yl) 2,3,4-trihydroxypentanedioate.
| Compound Name | 1-O-[3-[3-(4-ethyl-2-hydroxy-4-methylhexyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]-2-hydroxypropyl] 5-O-(2-methylbutan-2-yl) 2,3,4-trihydroxypentanedioate |
|---|---|
| PubChem CID | 89121095 |
| Molecular Formula | C28H47N3O12 |
| Molecular Weight | 617.69 g/mol |
| Exact Mass | 617.32 |
| IUPAC Name | 1-O-[3-[3-(4-ethyl-2-hydroxy-4-methylhexyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]-2-hydroxypropyl] 5-O-(2-methylbutan-2-yl) 2,3,4-trihydroxypentanedioate |
| SMILES | C=CCn1c(=O)n(CC(O)COC(=O)C(O)C(O)C(O)C(=O)OC(C)(C)CC)c(=O)n(CC(O)CC(C)(CC)CC)c1=O |
| InChI | InChI=1S/C28H47N3O12/c1-8-12-29-24(39)30(14-17(32)13-28(7,10-3)11-4)26(41)31(25(29)40)15-18(33)16-42-22(37)20(35)19(34)21(36)23(38)43-27(5,6)9-2/h8,17-21,32-36H,1,9-16H2,2-7H3 |
| InChIKey | IZYACFHCPJAJTJ-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 219.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.69 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|