C26H43N3O12 — CID 89121096
1-O-[2-hydroxy-3-[3-(2-hydroxy-4,4-dimethylhexyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 6-O-propan-2-yl 2,3,4-trihydroxyhexanedioate (PubChem CID 89121096) has the molecular formula C26H43N3O12 and a molecular weight of 589.64 g/mol. Its IUPAC name is 1-O-[2-hydroxy-3-[3-(2-hydroxy-4,4-dimethylhexyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 6-O-propan-2-yl 2,3,4-trihydroxyhexanedioate.
| Compound Name | 1-O-[2-hydroxy-3-[3-(2-hydroxy-4,4-dimethylhexyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 6-O-propan-2-yl 2,3,4-trihydroxyhexanedioate |
|---|---|
| PubChem CID | 89121096 |
| Molecular Formula | C26H43N3O12 |
| Molecular Weight | 589.64 g/mol |
| Exact Mass | 589.28 |
| IUPAC Name | 1-O-[2-hydroxy-3-[3-(2-hydroxy-4,4-dimethylhexyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 6-O-propan-2-yl 2,3,4-trihydroxyhexanedioate |
| SMILES | C=CCn1c(=O)n(CC(O)COC(=O)C(O)C(O)C(O)CC(=O)OC(C)C)c(=O)n(CC(O)CC(C)(C)CC)c1=O |
| InChI | InChI=1S/C26H43N3O12/c1-7-9-27-23(37)28(12-16(30)11-26(5,6)8-2)25(39)29(24(27)38)13-17(31)14-40-22(36)21(35)20(34)18(32)10-19(33)41-15(3)4/h7,15-18,20-21,30-32,34-35H,1,8-14H2,2-6H3 |
| InChIKey | DMRVJEDISCLSDJ-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 219.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.64 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|