C28H47N3O13 — CID 89121098
6-O-tert-butyl 1-O-[3-[3-(4-ethyl-2-hydroxy-4-methylhexyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]-2-hydroxypropyl] 2,3,4,5-tetrahydroxyhexanedioate (PubChem CID 89121098) has the molecular formula C28H47N3O13 and a molecular weight of 633.69 g/mol. Its IUPAC name is 6-O-tert-butyl 1-O-[3-[3-(4-ethyl-2-hydroxy-4-methylhexyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]-2-hydroxypropyl] 2,3,4,5-tetrahydroxyhexanedioate.
| Compound Name | 6-O-tert-butyl 1-O-[3-[3-(4-ethyl-2-hydroxy-4-methylhexyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]-2-hydroxypropyl] 2,3,4,5-tetrahydroxyhexanedioate |
|---|---|
| PubChem CID | 89121098 |
| Molecular Formula | C28H47N3O13 |
| Molecular Weight | 633.69 g/mol |
| Exact Mass | 633.31 |
| IUPAC Name | 6-O-tert-butyl 1-O-[3-[3-(4-ethyl-2-hydroxy-4-methylhexyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]-2-hydroxypropyl] 2,3,4,5-tetrahydroxyhexanedioate |
| SMILES | C=CCn1c(=O)n(CC(O)COC(=O)C(O)C(O)C(O)C(O)C(=O)OC(C)(C)C)c(=O)n(CC(O)CC(C)(CC)CC)c1=O |
| InChI | InChI=1S/C28H47N3O13/c1-8-11-29-24(40)30(13-16(32)12-28(7,9-2)10-3)26(42)31(25(29)41)14-17(33)15-43-22(38)20(36)18(34)19(35)21(37)23(39)44-27(4,5)6/h8,16-21,32-37H,1,9-15H2,2-7H3 |
| InChIKey | BHNMFSDUTHZULL-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 239.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.69 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|