C18H15N3O3 — CID 89121160
(2E,4E,6E)-2-cyano-7-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)hepta-2,4,6-trienoic acid (PubChem CID 89121160) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is (2E,4E,6E)-2-cyano-7-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)hepta-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6E)-2-cyano-7-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)hepta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 89121160 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | (2E,4E,6E)-2-cyano-7-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)hepta-2,4,6-trienoic acid |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=O)c1/C=C/C=C/C=C(\C#N)C(=O)O |
| InChI | InChI=1S/C18H15N3O3/c1-13-16(11-7-2-4-8-14(12-19)18(23)24)17(22)21(20-13)15-9-5-3-6-10-15/h2-11,20H,1H3,(H,23,24)/b4-2+,11-7+,14-8+ |
| InChIKey | MNAYBAIQOXDKGF-DLFPHZPOSA-N |
| XLogP | 2.58 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|