C24H23FN6O — CID 89121211
6-ethynyl-8-fluoro-N-[3-(2-methyl-3,4-dihydropyrazol-4-yl)-5-[(3R)-pyrrolidin-3-yl]oxyphenyl]quinazolin-2-amine (PubChem CID 89121211) has the molecular formula C24H23FN6O and a molecular weight of 430.49 g/mol. Its IUPAC name is 6-ethynyl-8-fluoro-N-[3-(2-methyl-3,4-dihydropyrazol-4-yl)-5-[(3R)-pyrrolidin-3-yl]oxyphenyl]quinazolin-2-amine.
| Compound Name | 6-ethynyl-8-fluoro-N-[3-(2-methyl-3,4-dihydropyrazol-4-yl)-5-[(3R)-pyrrolidin-3-yl]oxyphenyl]quinazolin-2-amine |
|---|---|
| PubChem CID | 89121211 |
| Molecular Formula | C24H23FN6O |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 6-ethynyl-8-fluoro-N-[3-(2-methyl-3,4-dihydropyrazol-4-yl)-5-[(3R)-pyrrolidin-3-yl]oxyphenyl]quinazolin-2-amine |
| SMILES | C#Cc1cc(F)c2nc(Nc3cc(O[C@@H]4CCNC4)cc(C4C=NN(C)C4)c3)ncc2c1 |
| InChI | InChI=1S/C24H23FN6O/c1-3-15-6-17-11-27-24(30-23(17)22(25)7-15)29-19-8-16(18-12-28-31(2)14-18)9-21(10-19)32-20-4-5-26-13-20/h1,6-12,18,20,26H,4-5,13-14H2,2H3,(H,27,29,30)/t18?,20-/m1/s1 |
| InChIKey | WRFCCFZIRQGCRE-ROPPNANJSA-N |
| XLogP | 3.25 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|