C24H20F6N2O2 — CID 89121402
N-[(1E,3Z)-1-amino-5-(trifluoromethyl)hexa-1,3,5-trien-2-yl]-2-oxo-2-phenyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide (PubChem CID 89121402) has the molecular formula C24H20F6N2O2 and a molecular weight of 482.42 g/mol. Its IUPAC name is N-[(1E,3Z)-1-amino-5-(trifluoromethyl)hexa-1,3,5-trien-2-yl]-2-oxo-2-phenyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide.
| Compound Name | N-[(1E,3Z)-1-amino-5-(trifluoromethyl)hexa-1,3,5-trien-2-yl]-2-oxo-2-phenyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 89121402 |
| Molecular Formula | C24H20F6N2O2 |
| Molecular Weight | 482.42 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | N-[(1E,3Z)-1-amino-5-(trifluoromethyl)hexa-1,3,5-trien-2-yl]-2-oxo-2-phenyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide |
| SMILES | C=C(/C=C\C(=C/N)N(CCc1ccc(C(F)(F)F)cc1)C(=O)C(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C24H20F6N2O2/c1-16(23(25,26)27)7-12-20(15-31)32(22(34)21(33)18-5-3-2-4-6-18)14-13-17-8-10-19(11-9-17)24(28,29)30/h2-12,15H,1,13-14,31H2/b12-7-,20-15+ |
| InChIKey | PDMPSRWFLYYSKG-NVDTWQGNSA-N |
| XLogP | 5.43 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.42 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|