C25H20BCl2NO5 — CID 89121448
CID 89121448 (PubChem CID 89121448) has the molecular formula C25H20BCl2NO5 and a molecular weight of 496.16 g/mol.
| Compound Name | CID 89121448 |
|---|---|
| PubChem CID | 89121448 |
| Molecular Formula | C25H20BCl2NO5 |
| Molecular Weight | 496.16 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(CCNC(=O)c2ccc(Oc3cc4c(cc3Cl)C(C(=O)O)CCO4)cc2)c(Cl)c1 |
| InChI | InChI=1S/C25H20BCl2NO5/c26-16-4-1-14(20(27)11-16)7-9-29-24(30)15-2-5-17(6-3-15)34-23-13-22-19(12-21(23)28)18(25(31)32)8-10-33-22/h1-6,11-13,18H,7-10H2,(H,29,30)(H,31,32) |
| InChIKey | VGMLZAWHLKVIHD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.16 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|