C14H26N4O — CID 89121450
(1Z,3E)-5-N-(2-methoxyethyl)-3-(4-methylpiperazin-1-yl)hexa-1,3,5-triene-1,5-diamine (PubChem CID 89121450) has the molecular formula C14H26N4O and a molecular weight of 266.39 g/mol. Its IUPAC name is (1Z,3E)-5-N-(2-methoxyethyl)-3-(4-methylpiperazin-1-yl)hexa-1,3,5-triene-1,5-diamine.
| Compound Name | (1Z,3E)-5-N-(2-methoxyethyl)-3-(4-methylpiperazin-1-yl)hexa-1,3,5-triene-1,5-diamine |
|---|---|
| PubChem CID | 89121450 |
| Molecular Formula | C14H26N4O |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | (1Z,3E)-5-N-(2-methoxyethyl)-3-(4-methylpiperazin-1-yl)hexa-1,3,5-triene-1,5-diamine |
| SMILES | C=C(/C=C(\C=C/N)N1CCN(C)CC1)NCCOC |
| InChI | InChI=1S/C14H26N4O/c1-13(16-6-11-19-3)12-14(4-5-15)18-9-7-17(2)8-10-18/h4-5,12,16H,1,6-11,15H2,2-3H3/b5-4-,14-12+ |
| InChIKey | PLCOHWAWVWANAO-NPKGFUJDSA-N |
| XLogP | 0.34 |
| TPSA | 53.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|