About (6S)-2,5-difluoro-7-methylbicyclo[4.1.1]octa-2,4-diene
(6S)-2,5-difluoro-7-methylbicyclo[4.1.1]octa-2,4-diene (PubChem CID 89121593) has the molecular formula C9H10F2
and a molecular weight of 156.18 g/mol. Its IUPAC name is (6S)-2,5-difluoro-7-methylbicyclo[4.1.1]octa-2,4-diene.
Molecular Properties
| Compound Name | (6S)-2,5-difluoro-7-methylbicyclo[4.1.1]octa-2,4-diene |
| PubChem CID | 89121593 |
| Molecular Formula | C9H10F2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | (6S)-2,5-difluoro-7-methylbicyclo[4.1.1]octa-2,4-diene |
| SMILES | CC1C2C[C@@H]1C(F)=CC=C2F |
| InChI | InChI=1S/C9H10F2/c1-5-6-4-7(5)9(11)3-2-8(6)10/h2-3,5-7H,4H2,1H3/t5?,6-,7?/m0/s1 |
| InChIKey | IFGLWLSQPPAERY-HUDPQJTASA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (6S)-2,5-difluoro-7-methylbicyclo[4.1.1]octa-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-2,5-difluoro-7-methylbicyclo[4.1.1]octa-2,4-diene?
The IUPAC name of (6S)-2,5-difluoro-7-methylbicyclo[4.1.1]octa-2,4-diene (CID 89121593) is (6S)-2,5-difluoro-7-methylbicyclo[4.1.1]octa-2,4-diene.
What is the SMILES notation for (6S)-2,5-difluoro-7-methylbicyclo[4.1.1]octa-2,4-diene?
The canonical SMILES for (6S)-2,5-difluoro-7-methylbicyclo[4.1.1]octa-2,4-diene is CC1C2C[C@@H]1C(F)=CC=C2F.
What is the InChIKey of (6S)-2,5-difluoro-7-methylbicyclo[4.1.1]octa-2,4-diene?
The InChIKey is IFGLWLSQPPAERY-HUDPQJTASA-N. The full InChI is InChI=1S/C9H10F2/c1-5-6-4-7(5)9(11)3-2-8(6)10/h2-3,5-7H,4H2,1H3/t5?,6-,7?/m0/s1.
What are the key properties of (6S)-2,5-difluoro-7-methylbicyclo[4.1.1]octa-2,4-diene?
(6S)-2,5-difluoro-7-methylbicyclo[4.1.1]octa-2,4-diene has a molecular weight of 156.18 g/mol, XLogP of 2.98, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-2,5-difluoro-7-methylbicyclo[4.1.1]octa-2,4-diene is sourced from PubChem (CID 89121593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).