C21H19BF2N6O2 — CID 89121747
3-[[3-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]-difluoromethyl]-6-(1-methylpyrazol-4-yl)-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 89121747) has the molecular formula C21H19BF2N6O2 and a molecular weight of 436.23 g/mol. Its IUPAC name is 3-[[3-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]-difluoromethyl]-6-(1-methylpyrazol-4-yl)-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 3-[[3-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]-difluoromethyl]-6-(1-methylpyrazol-4-yl)-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 89121747 |
| Molecular Formula | C21H19BF2N6O2 |
| Molecular Weight | 436.23 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 3-[[3-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]-difluoromethyl]-6-(1-methylpyrazol-4-yl)-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | C=C1OB(c2cccc(C(F)(F)c3nnc4ccc(-c5cnn(C)c5)nn34)c2)OC1(C)C |
| InChI | InChI=1S/C21H19BF2N6O2/c1-13-20(2,3)32-22(31-13)16-7-5-6-15(10-16)21(23,24)19-27-26-18-9-8-17(28-30(18)19)14-11-25-29(4)12-14/h5-12H,1H2,2-4H3 |
| InChIKey | FMQXSSLYBHWOTE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 79.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|