About (2S)-N-ethyl-2-(hydroxymethyl)-N,3,3-trimethylbutanamide
(2S)-N-ethyl-2-(hydroxymethyl)-N,3,3-trimethylbutanamide (PubChem CID 89121964) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is (2S)-N-ethyl-2-(hydroxymethyl)-N,3,3-trimethylbutanamide.
Molecular Properties
| Compound Name | (2S)-N-ethyl-2-(hydroxymethyl)-N,3,3-trimethylbutanamide |
| PubChem CID | 89121964 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | (2S)-N-ethyl-2-(hydroxymethyl)-N,3,3-trimethylbutanamide |
| SMILES | CCN(C)C(=O)[C@H](CO)C(C)(C)C |
| InChI | InChI=1S/C10H21NO2/c1-6-11(5)9(13)8(7-12)10(2,3)4/h8,12H,6-7H2,1-5H3/t8-/m0/s1 |
| InChIKey | RYYZCLCLODAVGL-QMMMGPOBSA-N |
| XLogP | 1.12 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-N-ethyl-2-(hydroxymethyl)-N,3,3-trimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-ethyl-2-(hydroxymethyl)-N,3,3-trimethylbutanamide?
The IUPAC name of (2S)-N-ethyl-2-(hydroxymethyl)-N,3,3-trimethylbutanamide (CID 89121964) is (2S)-N-ethyl-2-(hydroxymethyl)-N,3,3-trimethylbutanamide.
What is the SMILES notation for (2S)-N-ethyl-2-(hydroxymethyl)-N,3,3-trimethylbutanamide?
The canonical SMILES for (2S)-N-ethyl-2-(hydroxymethyl)-N,3,3-trimethylbutanamide is CCN(C)C(=O)[C@H](CO)C(C)(C)C.
What is the InChIKey of (2S)-N-ethyl-2-(hydroxymethyl)-N,3,3-trimethylbutanamide?
The InChIKey is RYYZCLCLODAVGL-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H21NO2/c1-6-11(5)9(13)8(7-12)10(2,3)4/h8,12H,6-7H2,1-5H3/t8-/m0/s1.
What are the key properties of (2S)-N-ethyl-2-(hydroxymethyl)-N,3,3-trimethylbutanamide?
(2S)-N-ethyl-2-(hydroxymethyl)-N,3,3-trimethylbutanamide has a molecular weight of 187.28 g/mol, XLogP of 1.12, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-ethyl-2-(hydroxymethyl)-N,3,3-trimethylbutanamide is sourced from PubChem (CID 89121964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).