About 3-phenylpropyl 4-bromobenzenesulfonate
3-phenylpropyl 4-bromobenzenesulfonate (PubChem CID 89122001) has the molecular formula C15H15BrO3S
and a molecular weight of 355.25 g/mol. Its IUPAC name is 3-phenylpropyl 4-bromobenzenesulfonate.
Molecular Properties
| Compound Name | 3-phenylpropyl 4-bromobenzenesulfonate |
| PubChem CID | 89122001 |
| Molecular Formula | C15H15BrO3S |
| Molecular Weight | 355.25 g/mol |
| Exact Mass | 353.99 |
| IUPAC Name | 3-phenylpropyl 4-bromobenzenesulfonate |
| SMILES | O=S(=O)(OCCCc1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H15BrO3S/c16-14-8-10-15(11-9-14)20(17,18)19-12-4-7-13-5-2-1-3-6-13/h1-3,5-6,8-11H,4,7,12H2 |
| InChIKey | UYTXSZUHUORABE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.25 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylpropyl 4-bromobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylpropyl 4-bromobenzenesulfonate?
The IUPAC name of 3-phenylpropyl 4-bromobenzenesulfonate (CID 89122001) is 3-phenylpropyl 4-bromobenzenesulfonate.
What is the SMILES notation for 3-phenylpropyl 4-bromobenzenesulfonate?
The canonical SMILES for 3-phenylpropyl 4-bromobenzenesulfonate is O=S(=O)(OCCCc1ccccc1)c1ccc(Br)cc1.
What is the InChIKey of 3-phenylpropyl 4-bromobenzenesulfonate?
The InChIKey is UYTXSZUHUORABE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15BrO3S/c16-14-8-10-15(11-9-14)20(17,18)19-12-4-7-13-5-2-1-3-6-13/h1-3,5-6,8-11H,4,7,12H2.
What are the key properties of 3-phenylpropyl 4-bromobenzenesulfonate?
3-phenylpropyl 4-bromobenzenesulfonate has a molecular weight of 355.25 g/mol, XLogP of 3.79, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylpropyl 4-bromobenzenesulfonate is sourced from PubChem (CID 89122001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).